C25H32F2N2O3S — CID 142216124
2-[4-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethyl]phenyl]sulfanylpropanoic acid (PubChem CID 142216124) has the molecular formula C25H32F2N2O3S and a molecular weight of 478.61 g/mol. Its IUPAC name is 2-[4-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[4-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 142216124 |
| Molecular Formula | C25H32F2N2O3S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 2-[4-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethyl]phenyl]sulfanylpropanoic acid |
| SMILES | CCCCCCCN(CCc1ccc(SC(C)C(=O)O)cc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C25H32F2N2O3S/c1-3-4-5-6-7-15-29(25(32)28-23-13-10-20(26)17-22(23)27)16-14-19-8-11-21(12-9-19)33-18(2)24(30)31/h8-13,17-18H,3-7,14-16H2,1-2H3,(H,28,32)(H,30,31) |
| InChIKey | DPHBCOHOCMOKCX-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|