C27H36F2N2O4 — CID 57438214
3-[3-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethyl]phenyl]-2-ethoxypropanoic acid (PubChem CID 57438214) has the molecular formula C27H36F2N2O4 and a molecular weight of 490.59 g/mol. Its IUPAC name is 3-[3-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethyl]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[3-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethyl]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 57438214 |
| Molecular Formula | C27H36F2N2O4 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 3-[3-[2-[(2,4-difluorophenyl)carbamoyl-heptylamino]ethyl]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCCCCN(CCc1cccc(CC(OCC)C(=O)O)c1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C27H36F2N2O4/c1-3-5-6-7-8-15-31(27(34)30-24-13-12-22(28)19-23(24)29)16-14-20-10-9-11-21(17-20)18-25(26(32)33)35-4-2/h9-13,17,19,25H,3-8,14-16,18H2,1-2H3,(H,30,34)(H,32,33) |
| InChIKey | OGMWPQLESJPABI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|