C26H43NO5 — CID 57438378
methyl 2-ethoxy-3-[3-[2-[heptyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl]propanoate (PubChem CID 57438378) has the molecular formula C26H43NO5 and a molecular weight of 449.63 g/mol. Its IUPAC name is methyl 2-ethoxy-3-[3-[2-[heptyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl]propanoate.
| Compound Name | methyl 2-ethoxy-3-[3-[2-[heptyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 57438378 |
| Molecular Formula | C26H43NO5 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | methyl 2-ethoxy-3-[3-[2-[heptyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl]propanoate |
| SMILES | CCCCCCCN(CCc1cccc(CC(OCC)C(=O)OC)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H43NO5/c1-7-9-10-11-12-17-27(25(29)32-26(3,4)5)18-16-21-14-13-15-22(19-21)20-23(31-8-2)24(28)30-6/h13-15,19,23H,7-12,16-18,20H2,1-6H3 |
| InChIKey | UVTHKPROIHJNOW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|