C21H29N3O2 — CID 129253519
tert-butyl N-[(3-aminophenyl)methyl]-N-[3-(3-aminophenyl)propyl]carbamate (PubChem CID 129253519) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl N-[(3-aminophenyl)methyl]-N-[3-(3-aminophenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[(3-aminophenyl)methyl]-N-[3-(3-aminophenyl)propyl]carbamate |
|---|---|
| PubChem CID | 129253519 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | tert-butyl N-[(3-aminophenyl)methyl]-N-[3-(3-aminophenyl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCc1cccc(N)c1)Cc1cccc(N)c1 |
| InChI | InChI=1S/C21H29N3O2/c1-21(2,3)26-20(25)24(15-17-8-5-11-19(23)14-17)12-6-9-16-7-4-10-18(22)13-16/h4-5,7-8,10-11,13-14H,6,9,12,15,22-23H2,1-3H3 |
| InChIKey | MIXJTMIBBJPVEF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|