C19H29NO5 — CID 12028342
2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl tert-butyl carbonate (PubChem CID 12028342) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is 2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl tert-butyl carbonate.
| Compound Name | 2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl tert-butyl carbonate |
|---|---|
| PubChem CID | 12028342 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OCCN(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29NO5/c1-18(2,3)24-16(21)20(14-15-10-8-7-9-11-15)12-13-23-17(22)25-19(4,5)6/h7-11H,12-14H2,1-6H3 |
| InChIKey | NASUASQWJUPDMD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |