C16H25NO5S — CID 59393893
3-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl methanesulfonate (PubChem CID 59393893) has the molecular formula C16H25NO5S and a molecular weight of 343.44 g/mol. Its IUPAC name is 3-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl methanesulfonate.
| Compound Name | 3-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl methanesulfonate |
|---|---|
| PubChem CID | 59393893 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N(CCCOS(C)(=O)=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H25NO5S/c1-16(2,3)22-15(18)17(11-8-12-21-23(4,19)20)13-14-9-6-5-7-10-14/h5-7,9-10H,8,11-13H2,1-4H3 |
| InChIKey | VWOGMUTUOJYQJO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|