C29H50N2O5 — CID 22006348
tert-butyl N-benzyl-N-[6-[6-hydroxyhexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexyl]carbamate (PubChem CID 22006348) has the molecular formula C29H50N2O5 and a molecular weight of 506.73 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[6-[6-hydroxyhexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[6-[6-hydroxyhexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 22006348 |
| Molecular Formula | C29H50N2O5 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.37 |
| IUPAC Name | tert-butyl N-benzyl-N-[6-[6-hydroxyhexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCO)CCCCCCN(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H50N2O5/c1-28(2,3)35-26(33)30(21-15-9-10-17-23-32)20-14-7-8-16-22-31(27(34)36-29(4,5)6)24-25-18-12-11-13-19-25/h11-13,18-19,32H,7-10,14-17,20-24H2,1-6H3 |
| InChIKey | ALIPMCZOJIFVCE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|