C20H34N2O2 — CID 146018002
tert-butyl N-(7-aminoheptyl)-N-(2-phenylethyl)carbamate (PubChem CID 146018002) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is tert-butyl N-(7-aminoheptyl)-N-(2-phenylethyl)carbamate.
| Compound Name | tert-butyl N-(7-aminoheptyl)-N-(2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 146018002 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | tert-butyl N-(7-aminoheptyl)-N-(2-phenylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCCN)CCc1ccccc1 |
| InChI | InChI=1S/C20H34N2O2/c1-20(2,3)24-19(23)22(16-11-6-4-5-10-15-21)17-14-18-12-8-7-9-13-18/h7-9,12-13H,4-6,10-11,14-17,21H2,1-3H3 |
| InChIKey | DSLZJEARMFEMFN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|