C15H22ClNO4S — CID 22475482
tert-butyl N-(chlorosulfonylmethyl)-N-(3-phenylpropyl)carbamate (PubChem CID 22475482) has the molecular formula C15H22ClNO4S and a molecular weight of 347.86 g/mol. Its IUPAC name is tert-butyl N-(chlorosulfonylmethyl)-N-(3-phenylpropyl)carbamate.
| Compound Name | tert-butyl N-(chlorosulfonylmethyl)-N-(3-phenylpropyl)carbamate |
|---|---|
| PubChem CID | 22475482 |
| Molecular Formula | C15H22ClNO4S |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | tert-butyl N-(chlorosulfonylmethyl)-N-(3-phenylpropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCc1ccccc1)CS(=O)(=O)Cl |
| InChI | InChI=1S/C15H22ClNO4S/c1-15(2,3)21-14(18)17(12-22(16,19)20)11-7-10-13-8-5-4-6-9-13/h4-6,8-9H,7,10-12H2,1-3H3 |
| InChIKey | WLDOZNOLMRQMAS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |