C23H39NO4 — CID 67024101
tert-butyl N-(2-hydroxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate (PubChem CID 67024101) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate.
| Compound Name | tert-butyl N-(2-hydroxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate |
|---|---|
| PubChem CID | 67024101 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | tert-butyl N-(2-hydroxyethyl)-N-[6-(4-phenylbutoxy)hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCO)CCCCCCOCCCCc1ccccc1 |
| InChI | InChI=1S/C23H39NO4/c1-23(2,3)28-22(26)24(17-18-25)16-10-4-5-11-19-27-20-12-9-15-21-13-7-6-8-14-21/h6-8,13-14,25H,4-5,9-12,15-20H2,1-3H3 |
| InChIKey | IQGQLVKCACLUIL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|