C38H62NO9P — CID 58014133
tert-butyl N-[(2R)-2-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-(hydroxymethyl)phenyl]-2-hydroxyethyl]-N-[6-(4-phenylbutoxy)hexyl]carbamate (PubChem CID 58014133) has the molecular formula C38H62NO9P and a molecular weight of 707.89 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-(hydroxymethyl)phenyl]-2-hydroxyethyl]-N-[6-(4-phenylbutoxy)hexyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-(hydroxymethyl)phenyl]-2-hydroxyethyl]-N-[6-(4-phenylbutoxy)hexyl]carbamate |
|---|---|
| PubChem CID | 58014133 |
| Molecular Formula | C38H62NO9P |
| Molecular Weight | 707.89 g/mol |
| Exact Mass | 707.42 |
| IUPAC Name | tert-butyl N-[(2R)-2-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-(hydroxymethyl)phenyl]-2-hydroxyethyl]-N-[6-(4-phenylbutoxy)hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCOCCCCc1ccccc1)C[C@H](O)c1ccc(OP(=O)(OC(C)(C)C)OC(C)(C)C)c(CO)c1 |
| InChI | InChI=1S/C38H62NO9P/c1-36(2,3)45-35(42)39(24-16-10-11-17-25-44-26-18-15-21-30-19-13-12-14-20-30)28-33(41)31-22-23-34(32(27-31)29-40)46-49(43,47-37(4,5)6)48-38(7,8)9/h12-14,19-20,22-23,27,33,40-41H,10-11,15-18,21,24-26,28-29H2,1-9H3/t33-/m0/s1 |
| InChIKey | FZYHAEADRHLJRZ-XIFFEERXSA-N |
| XLogP | 9.17 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.89 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|