C23H40N2O3 — CID 22006341
tert-butyl N-benzyl-N-[6-(5-hydroxypentylamino)hexyl]carbamate (PubChem CID 22006341) has the molecular formula C23H40N2O3 and a molecular weight of 392.58 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[6-(5-hydroxypentylamino)hexyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[6-(5-hydroxypentylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 22006341 |
| Molecular Formula | C23H40N2O3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | tert-butyl N-benzyl-N-[6-(5-hydroxypentylamino)hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCNCCCCCO)Cc1ccccc1 |
| InChI | InChI=1S/C23H40N2O3/c1-23(2,3)28-22(27)25(20-21-14-8-6-9-15-21)18-12-5-4-10-16-24-17-11-7-13-19-26/h6,8-9,14-15,24,26H,4-5,7,10-13,16-20H2,1-3H3 |
| InChIKey | ZQUQADMBCAKGGG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|