C18H27NO3 — CID 146629993
tert-butyl N-benzyl-N-(3,3-dimethyl-4-oxobutyl)carbamate (PubChem CID 146629993) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-(3,3-dimethyl-4-oxobutyl)carbamate.
| Compound Name | tert-butyl N-benzyl-N-(3,3-dimethyl-4-oxobutyl)carbamate |
|---|---|
| PubChem CID | 146629993 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl N-benzyl-N-(3,3-dimethyl-4-oxobutyl)carbamate |
| SMILES | CC(C)(C=O)CCN(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO3/c1-17(2,3)22-16(21)19(12-11-18(4,5)14-20)13-15-9-7-6-8-10-15/h6-10,14H,11-13H2,1-5H3 |
| InChIKey | ZSKSHKBZRKKQKT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|