C20H22F3NO2 — CID 141074386
tert-butyl N-benzyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 141074386) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 141074386 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | tert-butyl N-benzyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3NO2/c1-19(2,3)26-18(25)24(13-15-7-5-4-6-8-15)14-16-9-11-17(12-10-16)20(21,22)23/h4-12H,13-14H2,1-3H3 |
| InChIKey | FPCAXHKQFWLIOV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |