C57H55NO2P2+2 — CID 102024480
[4-[[(2-methylpropan-2-yl)oxycarbonyl-[[4-(triphenylphosphaniumylmethyl)phenyl]methyl]amino]methyl]phenyl]methyl-triphenylphosphanium (PubChem CID 102024480) has the molecular formula C57H55NO2P2+2 and a molecular weight of 848.02 g/mol. Its IUPAC name is [4-[[(2-methylpropan-2-yl)oxycarbonyl-[[4-(triphenylphosphaniumylmethyl)phenyl]methyl]amino]methyl]phenyl]methyl-triphenylphosphanium.
| Compound Name | [4-[[(2-methylpropan-2-yl)oxycarbonyl-[[4-(triphenylphosphaniumylmethyl)phenyl]methyl]amino]methyl]phenyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 102024480 |
| Molecular Formula | C57H55NO2P2+2 |
| Molecular Weight | 848.02 g/mol |
| Exact Mass | 847.37 |
| IUPAC Name | [4-[[(2-methylpropan-2-yl)oxycarbonyl-[[4-(triphenylphosphaniumylmethyl)phenyl]methyl]amino]methyl]phenyl]methyl-triphenylphosphanium |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1)Cc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C57H55NO2P2/c1-57(2,3)60-56(59)58(42-46-34-38-48(39-35-46)44-61(50-22-10-4-11-23-50,51-24-12-5-13-25-51)52-26-14-6-15-27-52)43-47-36-40-49(41-37-47)45-62(53-28-16-7-17-29-53,54-30-18-8-19-31-54)55-32-20-9-21-33-55/h4-41H,42-45H2,1-3H3/q+2 |
| InChIKey | NFODIKTYYLHFQM-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.02 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|