C15H23NO3 — CID 10015720
tert-butyl N-benzyl-N-(3-hydroxypropyl)carbamate (PubChem CID 10015720) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-(3-hydroxypropyl)carbamate.
| Compound Name | tert-butyl N-benzyl-N-(3-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 10015720 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | tert-butyl N-benzyl-N-(3-hydroxypropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCO)Cc1ccccc1 |
| InChI | InChI=1S/C15H23NO3/c1-15(2,3)19-14(18)16(10-7-11-17)12-13-8-5-4-6-9-13/h4-6,8-9,17H,7,10-12H2,1-3H3 |
| InChIKey | ZPKUIUGWAFVCMC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |