About [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate
[benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate (PubChem CID 102250598) has the molecular formula C15H21NO5
and a molecular weight of 295.33 g/mol. Its IUPAC name is [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate.
Molecular Properties
| Compound Name | [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate |
| PubChem CID | 102250598 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO5/c1-15(2,3)21-14(19)20-13(18)16(9-10-17)11-12-7-5-4-6-8-12/h4-8,17H,9-11H2,1-3H3 |
| InChIKey | ISKSSOHVPKVHON-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate?
The IUPAC name of [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate (CID 102250598) is [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate.
What is the SMILES notation for [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate?
The canonical SMILES for [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate is CC(C)(C)OC(=O)OC(=O)N(CCO)Cc1ccccc1.
What is the InChIKey of [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate?
The InChIKey is ISKSSOHVPKVHON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO5/c1-15(2,3)21-14(19)20-13(18)16(9-10-17)11-12-7-5-4-6-8-12/h4-8,17H,9-11H2,1-3H3.
What are the key properties of [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate?
[benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate has a molecular weight of 295.33 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [benzyl(2-hydroxyethyl)carbamoyl] tert-butyl carbonate is sourced from PubChem (CID 102250598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).