C21H33NO4 — CID 59035591
methyl 6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,2-dimethylhexanoate (PubChem CID 59035591) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is methyl 6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,2-dimethylhexanoate.
| Compound Name | methyl 6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 59035591 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | methyl 6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,2-dimethylhexanoate |
| SMILES | COC(=O)C(C)(C)CCCCN(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33NO4/c1-20(2,3)26-19(24)22(16-17-12-8-7-9-13-17)15-11-10-14-21(4,5)18(23)25-6/h7-9,12-13H,10-11,14-16H2,1-6H3 |
| InChIKey | AUOSJTDFMJBQJT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|