C13H16F3N2O2- — CID 144685183
[(2-methylpropan-2-yl)oxycarbonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]azanide (PubChem CID 144685183) has the molecular formula C13H16F3N2O2- and a molecular weight of 289.28 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]azanide.
| Compound Name | [(2-methylpropan-2-yl)oxycarbonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]azanide |
|---|---|
| PubChem CID | 144685183 |
| Molecular Formula | C13H16F3N2O2- |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]azanide |
| SMILES | CC(C)(C)OC(=O)N([NH-])Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3N2O2/c1-12(2,3)20-11(19)18(17)8-9-4-6-10(7-5-9)13(14,15)16/h4-7,17H,8H2,1-3H3/q-1 |
| InChIKey | KQCZRSJIMDXGBF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 53.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|