C12H14F3NO2 — CID 60636161
ethyl N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 60636161) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is ethyl N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | ethyl N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 60636161 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | ethyl N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | CCOC(=O)N(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO2/c1-3-18-11(17)16(2)8-9-4-6-10(7-5-9)12(13,14)15/h4-7H,3,8H2,1-2H3 |
| InChIKey | QLUNBORLHKCISG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |