C17H15BrF3NO — CID 55330788
2-(4-bromophenyl)-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 55330788) has the molecular formula C17H15BrF3NO and a molecular weight of 386.21 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55330788 |
| Molecular Formula | C17H15BrF3NO |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-(4-bromophenyl)-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CN(Cc1ccc(C(F)(F)F)cc1)C(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrF3NO/c1-22(16(23)10-12-4-8-15(18)9-5-12)11-13-2-6-14(7-3-13)17(19,20)21/h2-9H,10-11H2,1H3 |
| InChIKey | SPPDMTHSCATAMO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |