C17H13F6NO2 — CID 177453696
[4-(trifluoromethyl)phenyl] N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 177453696) has the molecular formula C17H13F6NO2 and a molecular weight of 377.28 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | [4-(trifluoromethyl)phenyl] N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 177453696 |
| Molecular Formula | C17H13F6NO2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | CN(Cc1ccc(C(F)(F)F)cc1)C(=O)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F6NO2/c1-24(10-11-2-4-12(5-3-11)16(18,19)20)15(25)26-14-8-6-13(7-9-14)17(21,22)23/h2-9H,10H2,1H3 |
| InChIKey | UEQGQMXNDCZVCE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |