C15H16F3NO — CID 102603438
N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]hexa-2,4-dienamide (PubChem CID 102603438) has the molecular formula C15H16F3NO and a molecular weight of 283.29 g/mol. Its IUPAC name is N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]hexa-2,4-dienamide.
| Compound Name | N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 102603438 |
| Molecular Formula | C15H16F3NO |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)N(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3NO/c1-3-4-5-6-14(20)19(2)11-12-7-9-13(10-8-12)15(16,17)18/h3-10H,11H2,1-2H3 |
| InChIKey | CVCRPTUISLMVQA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|