C17H23F3N2O3 — CID 155164381
tert-butyl (4R)-4-amino-5-oxo-5-[[4-(trifluoromethyl)phenyl]methylamino]pentanoate (PubChem CID 155164381) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is tert-butyl (4R)-4-amino-5-oxo-5-[[4-(trifluoromethyl)phenyl]methylamino]pentanoate.
| Compound Name | tert-butyl (4R)-4-amino-5-oxo-5-[[4-(trifluoromethyl)phenyl]methylamino]pentanoate |
|---|---|
| PubChem CID | 155164381 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | tert-butyl (4R)-4-amino-5-oxo-5-[[4-(trifluoromethyl)phenyl]methylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](N)C(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-16(2,3)25-14(23)9-8-13(21)15(24)22-10-11-4-6-12(7-5-11)17(18,19)20/h4-7,13H,8-10,21H2,1-3H3,(H,22,24)/t13-/m1/s1 |
| InChIKey | GKKGIKBWHJKUCO-CYBMUJFWSA-N |
| XLogP | 2.77 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |