C16H23F3N2O2 — CID 103389858
tert-butyl N-[2-[[4-(trifluoromethyl)phenyl]methylamino]propyl]carbamate (PubChem CID 103389858) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(trifluoromethyl)phenyl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(trifluoromethyl)phenyl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 103389858 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl N-[2-[[4-(trifluoromethyl)phenyl]methylamino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H23F3N2O2/c1-11(9-21-14(22)23-15(2,3)4)20-10-12-5-7-13(8-6-12)16(17,18)19/h5-8,11,20H,9-10H2,1-4H3,(H,21,22) |
| InChIKey | VRWMKXIPOZCICV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |