C11H21F3N2O2 — CID 103389896
tert-butyl N-[2-(3,3,3-trifluoropropylamino)propyl]carbamate (PubChem CID 103389896) has the molecular formula C11H21F3N2O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is tert-butyl N-[2-(3,3,3-trifluoropropylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,3,3-trifluoropropylamino)propyl]carbamate |
|---|---|
| PubChem CID | 103389896 |
| Molecular Formula | C11H21F3N2O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | tert-butyl N-[2-(3,3,3-trifluoropropylamino)propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)NCCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O2/c1-8(15-6-5-11(12,13)14)7-16-9(17)18-10(2,3)4/h8,15H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | NYGMOCOUGKAJKM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |