C11H24N2O3S — CID 103390998
tert-butyl N-[2-(2-methylsulfinylethylamino)propyl]carbamate (PubChem CID 103390998) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is tert-butyl N-[2-(2-methylsulfinylethylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-methylsulfinylethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 103390998 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | tert-butyl N-[2-(2-methylsulfinylethylamino)propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)NCCS(C)=O |
| InChI | InChI=1S/C11H24N2O3S/c1-9(12-6-7-17(5)15)8-13-10(14)16-11(2,3)4/h9,12H,6-8H2,1-5H3,(H,13,14) |
| InChIKey | ZJOCCHNVJLAZOY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |