C11H24N2O3 — CID 103386968
tert-butyl N-[2-(2-methoxyethylamino)propyl]carbamate (PubChem CID 103386968) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is tert-butyl N-[2-(2-methoxyethylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-methoxyethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 103386968 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | tert-butyl N-[2-(2-methoxyethylamino)propyl]carbamate |
| SMILES | COCCNC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H24N2O3/c1-9(12-6-7-15-5)8-13-10(14)16-11(2,3)4/h9,12H,6-8H2,1-5H3,(H,13,14) |
| InChIKey | HXWIPAPWUCAMHF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|