C13H29N3O2 — CID 103389411
tert-butyl N-[2-[2-(dimethylamino)propylamino]propyl]carbamate (PubChem CID 103389411) has the molecular formula C13H29N3O2 and a molecular weight of 259.39 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(dimethylamino)propylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(dimethylamino)propylamino]propyl]carbamate |
|---|---|
| PubChem CID | 103389411 |
| Molecular Formula | C13H29N3O2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | tert-butyl N-[2-[2-(dimethylamino)propylamino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)NCC(C)N(C)C |
| InChI | InChI=1S/C13H29N3O2/c1-10(14-9-11(2)16(6)7)8-15-12(17)18-13(3,4)5/h10-11,14H,8-9H2,1-7H3,(H,15,17) |
| InChIKey | MALNERXYAFDNOP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |