C16H35N3O2 — CID 103387660
tert-butyl N-[2-[[2-(dimethylamino)-4-methylpentyl]amino]propyl]carbamate (PubChem CID 103387660) has the molecular formula C16H35N3O2 and a molecular weight of 301.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(dimethylamino)-4-methylpentyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(dimethylamino)-4-methylpentyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 103387660 |
| Molecular Formula | C16H35N3O2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.27 |
| IUPAC Name | tert-butyl N-[2-[[2-(dimethylamino)-4-methylpentyl]amino]propyl]carbamate |
| SMILES | CC(C)CC(CNC(C)CNC(=O)OC(C)(C)C)N(C)C |
| InChI | InChI=1S/C16H35N3O2/c1-12(2)9-14(19(7)8)11-17-13(3)10-18-15(20)21-16(4,5)6/h12-14,17H,9-11H2,1-8H3,(H,18,20) |
| InChIKey | FRAZADDEUIKZTR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |