C15H30N2O4 — CID 103388232
methyl 4-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-ylamino]pentanoate (PubChem CID 103388232) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is methyl 4-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-ylamino]pentanoate.
| Compound Name | methyl 4-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-ylamino]pentanoate |
|---|---|
| PubChem CID | 103388232 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | methyl 4-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-ylamino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O4/c1-10(2)8-12(13(18)20-7)17-11(3)9-16-14(19)21-15(4,5)6/h10-12,17H,8-9H2,1-7H3,(H,16,19) |
| InChIKey | HHMTXHZRMIRMCB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |