C16H34N2O4 — CID 107252224
tert-butyl N-[2-(1,1-dimethoxypropan-2-ylamino)-4-methylpentyl]carbamate (PubChem CID 107252224) has the molecular formula C16H34N2O4 and a molecular weight of 318.46 g/mol. Its IUPAC name is tert-butyl N-[2-(1,1-dimethoxypropan-2-ylamino)-4-methylpentyl]carbamate.
| Compound Name | tert-butyl N-[2-(1,1-dimethoxypropan-2-ylamino)-4-methylpentyl]carbamate |
|---|---|
| PubChem CID | 107252224 |
| Molecular Formula | C16H34N2O4 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | tert-butyl N-[2-(1,1-dimethoxypropan-2-ylamino)-4-methylpentyl]carbamate |
| SMILES | COC(OC)C(C)NC(CNC(=O)OC(C)(C)C)CC(C)C |
| InChI | InChI=1S/C16H34N2O4/c1-11(2)9-13(18-12(3)14(20-7)21-8)10-17-15(19)22-16(4,5)6/h11-14,18H,9-10H2,1-8H3,(H,17,19) |
| InChIKey | IOMCXGHYZASFHG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|