C13H26F2N2O2 — CID 107253648
tert-butyl N-[2-(1,1-difluoropropan-2-ylamino)pentyl]carbamate (PubChem CID 107253648) has the molecular formula C13H26F2N2O2 and a molecular weight of 280.36 g/mol. Its IUPAC name is tert-butyl N-[2-(1,1-difluoropropan-2-ylamino)pentyl]carbamate.
| Compound Name | tert-butyl N-[2-(1,1-difluoropropan-2-ylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 107253648 |
| Molecular Formula | C13H26F2N2O2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | tert-butyl N-[2-(1,1-difluoropropan-2-ylamino)pentyl]carbamate |
| SMILES | CCCC(CNC(=O)OC(C)(C)C)NC(C)C(F)F |
| InChI | InChI=1S/C13H26F2N2O2/c1-6-7-10(17-9(2)11(14)15)8-16-12(18)19-13(3,4)5/h9-11,17H,6-8H2,1-5H3,(H,16,18) |
| InChIKey | JSPGKQXGGGMEKZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |