C18H30N2O3 — CID 107253639
tert-butyl N-[2-[1-(4-hydroxyphenyl)ethylamino]pentyl]carbamate (PubChem CID 107253639) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(4-hydroxyphenyl)ethylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(4-hydroxyphenyl)ethylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 107253639 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl N-[2-[1-(4-hydroxyphenyl)ethylamino]pentyl]carbamate |
| SMILES | CCCC(CNC(=O)OC(C)(C)C)NC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H30N2O3/c1-6-7-15(12-19-17(22)23-18(3,4)5)20-13(2)14-8-10-16(21)11-9-14/h8-11,13,15,20-21H,6-7,12H2,1-5H3,(H,19,22) |
| InChIKey | LOVNWGXRWXYGRC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |