C22H30N2O2 — CID 70806696
tert-butyl N-[(2S)-2-[[(1S)-1-(4-phenylphenyl)ethyl]amino]propyl]carbamate (PubChem CID 70806696) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[[(1S)-1-(4-phenylphenyl)ethyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[[(1S)-1-(4-phenylphenyl)ethyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 70806696 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | tert-butyl N-[(2S)-2-[[(1S)-1-(4-phenylphenyl)ethyl]amino]propyl]carbamate |
| SMILES | C[C@H](N[C@@H](C)CNC(=O)OC(C)(C)C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H30N2O2/c1-16(15-23-21(25)26-22(3,4)5)24-17(2)18-11-13-20(14-12-18)19-9-7-6-8-10-19/h6-14,16-17,24H,15H2,1-5H3,(H,23,25)/t16-,17-/m0/s1 |
| InChIKey | CSNMFGIAYSWUIE-IRXDYDNUSA-N |
| XLogP | 4.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |