C17H28N2O2 — CID 103390508
tert-butyl N-[2-[[(1R)-1-(2-methylphenyl)ethyl]amino]propyl]carbamate (PubChem CID 103390508) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is tert-butyl N-[2-[[(1R)-1-(2-methylphenyl)ethyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(1R)-1-(2-methylphenyl)ethyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 103390508 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | tert-butyl N-[2-[[(1R)-1-(2-methylphenyl)ethyl]amino]propyl]carbamate |
| SMILES | Cc1ccccc1[C@@H](C)NC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N2O2/c1-12-9-7-8-10-15(12)14(3)19-13(2)11-18-16(20)21-17(4,5)6/h7-10,13-14,19H,11H2,1-6H3,(H,18,20)/t13?,14-/m1/s1 |
| InChIKey | AOJYIBNSEMPJCL-ARLHGKGLSA-N |
| XLogP | 3.56 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |