C17H28N2O3 — CID 107862352
tert-butyl N-[2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]propyl]carbamate (PubChem CID 107862352) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 107862352 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | tert-butyl N-[2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)N[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C17H28N2O3/c1-13(11-18-16(21)22-17(2,3)4)19-15(12-20)10-14-8-6-5-7-9-14/h5-9,13,15,19-20H,10-12H2,1-4H3,(H,18,21)/t13?,15-/m0/s1 |
| InChIKey | LGYUWJLBHVPLGI-WUJWULDRSA-N |
| XLogP | 2.09 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |