C18H27N3O4S — CID 101484117
(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]carbamothioylamino]propanoic acid (PubChem CID 101484117) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]carbamothioylamino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 101484117 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]carbamothioylamino]propanoic acid |
| SMILES | C[C@H](NC(=S)NC[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C18H27N3O4S/c1-12(15(22)23)20-16(26)19-11-14(10-13-8-6-5-7-9-13)21-17(24)25-18(2,3)4/h5-9,12,14H,10-11H2,1-4H3,(H,21,24)(H,22,23)(H2,19,20,26)/t12-,14-/m0/s1 |
| InChIKey | KHTWDGKEUOJJRE-JSGCOSHPSA-N |
| XLogP | 2.06 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|