C18H26N2O4S2 — CID 102422365
methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]carbamothioylsulfanyl]acetate (PubChem CID 102422365) has the molecular formula C18H26N2O4S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]carbamothioylsulfanyl]acetate.
| Compound Name | methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]carbamothioylsulfanyl]acetate |
|---|---|
| PubChem CID | 102422365 |
| Molecular Formula | C18H26N2O4S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | methyl 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropyl]carbamothioylsulfanyl]acetate |
| SMILES | COC(=O)CSC(=S)NC[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26N2O4S2/c1-18(2,3)24-16(22)20-14(10-13-8-6-5-7-9-13)11-19-17(25)26-12-15(21)23-4/h5-9,14H,10-12H2,1-4H3,(H,19,25)(H,20,22)/t14-/m0/s1 |
| InChIKey | MZTRIMJSOGVJKX-AWEZNQCLSA-N |
| XLogP | 2.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|