C14H30N2O3 — CID 103389494
tert-butyl N-[2-[(1-hydroxy-4-methylpentan-2-yl)amino]propyl]carbamate (PubChem CID 103389494) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is tert-butyl N-[2-[(1-hydroxy-4-methylpentan-2-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[(1-hydroxy-4-methylpentan-2-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 103389494 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | tert-butyl N-[2-[(1-hydroxy-4-methylpentan-2-yl)amino]propyl]carbamate |
| SMILES | CC(C)CC(CO)NC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H30N2O3/c1-10(2)7-12(9-17)16-11(3)8-15-13(18)19-14(4,5)6/h10-12,16-17H,7-9H2,1-6H3,(H,15,18) |
| InChIKey | RLAMXKHIDKYZJX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |