C13H28N2O3 — CID 103391068
tert-butyl N-[2-(1-hydroxypentan-3-ylamino)propyl]carbamate (PubChem CID 103391068) has the molecular formula C13H28N2O3 and a molecular weight of 260.38 g/mol. Its IUPAC name is tert-butyl N-[2-(1-hydroxypentan-3-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(1-hydroxypentan-3-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 103391068 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | tert-butyl N-[2-(1-hydroxypentan-3-ylamino)propyl]carbamate |
| SMILES | CCC(CCO)NC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H28N2O3/c1-6-11(7-8-16)15-10(2)9-14-12(17)18-13(3,4)5/h10-11,15-16H,6-9H2,1-5H3,(H,14,17) |
| InChIKey | WADRZSMKCKPCCW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |