C12H26N2O3 — CID 167219816
tert-butyl N-[2-(1-ethoxyethylamino)propyl]carbamate (PubChem CID 167219816) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is tert-butyl N-[2-(1-ethoxyethylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(1-ethoxyethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 167219816 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | tert-butyl N-[2-(1-ethoxyethylamino)propyl]carbamate |
| SMILES | CCOC(C)NC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H26N2O3/c1-7-16-10(3)14-9(2)8-13-11(15)17-12(4,5)6/h9-10,14H,7-8H2,1-6H3,(H,13,15) |
| InChIKey | GGOHAOSXYZORFE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|