C11H23NO3 — CID 87400882
tert-butyl N-[(2R)-3-hydroxy-2,3-dimethylbutyl]carbamate (PubChem CID 87400882) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-hydroxy-2,3-dimethylbutyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-hydroxy-2,3-dimethylbutyl]carbamate |
|---|---|
| PubChem CID | 87400882 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | tert-butyl N-[(2R)-3-hydroxy-2,3-dimethylbutyl]carbamate |
| SMILES | C[C@H](CNC(=O)OC(C)(C)C)C(C)(C)O |
| InChI | InChI=1S/C11H23NO3/c1-8(11(5,6)14)7-12-9(13)15-10(2,3)4/h8,14H,7H2,1-6H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | ZDZPKYCXWRFGIB-MRVPVSSYSA-N |
| XLogP | 1.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |