C9H18BrNO2 — CID 86601426
tert-butyl N-[(2R)-3-bromo-2-methylpropyl]carbamate (PubChem CID 86601426) has the molecular formula C9H18BrNO2 and a molecular weight of 252.15 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-bromo-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-bromo-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 86601426 |
| Molecular Formula | C9H18BrNO2 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | tert-butyl N-[(2R)-3-bromo-2-methylpropyl]carbamate |
| SMILES | C[C@@H](CBr)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18BrNO2/c1-7(5-10)6-11-8(12)13-9(2,3)4/h7H,5-6H2,1-4H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | HYTMOLGBQNHTPA-ZETCQYMHSA-N |
| XLogP | 2.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|