C12H26N2O2 — CID 116861265
tert-butyl N-[3,3-dimethyl-2-(methylamino)butyl]carbamate (PubChem CID 116861265) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is tert-butyl N-[3,3-dimethyl-2-(methylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[3,3-dimethyl-2-(methylamino)butyl]carbamate |
|---|---|
| PubChem CID | 116861265 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | tert-butyl N-[3,3-dimethyl-2-(methylamino)butyl]carbamate |
| SMILES | CNC(CNC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-11(2,3)9(13-7)8-14-10(15)16-12(4,5)6/h9,13H,8H2,1-7H3,(H,14,15) |
| InChIKey | MGMUQNNBZTUISG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |