C10H22N2O2 — CID 71437538
tert-butyl N-(2-amino-3-methylbutyl)carbamate (PubChem CID 71437538) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is tert-butyl N-(2-amino-3-methylbutyl)carbamate.
| Compound Name | tert-butyl N-(2-amino-3-methylbutyl)carbamate |
|---|---|
| PubChem CID | 71437538 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | tert-butyl N-(2-amino-3-methylbutyl)carbamate |
| SMILES | CC(C)C(N)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H22N2O2/c1-7(2)8(11)6-12-9(13)14-10(3,4)5/h7-8H,6,11H2,1-5H3,(H,12,13) |
| InChIKey | YWAMFTBALAAREO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |