C14H30N2O4 — CID 107254177
tert-butyl N-[2-(2,2-dimethoxyethylamino)-3-methylbutyl]carbamate (PubChem CID 107254177) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is tert-butyl N-[2-(2,2-dimethoxyethylamino)-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,2-dimethoxyethylamino)-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 107254177 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | tert-butyl N-[2-(2,2-dimethoxyethylamino)-3-methylbutyl]carbamate |
| SMILES | COC(CNC(CNC(=O)OC(C)(C)C)C(C)C)OC |
| InChI | InChI=1S/C14H30N2O4/c1-10(2)11(15-9-12(18-6)19-7)8-16-13(17)20-14(3,4)5/h10-12,15H,8-9H2,1-7H3,(H,16,17) |
| InChIKey | UQPJUCSOFOXRJL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|