C17H28N2O4 — CID 107254041
tert-butyl N-[2-[(2,4-dihydroxyphenyl)methylamino]-3-methylbutyl]carbamate (PubChem CID 107254041) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,4-dihydroxyphenyl)methylamino]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2,4-dihydroxyphenyl)methylamino]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 107254041 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butyl N-[2-[(2,4-dihydroxyphenyl)methylamino]-3-methylbutyl]carbamate |
| SMILES | CC(C)C(CNC(=O)OC(C)(C)C)NCc1ccc(O)cc1O |
| InChI | InChI=1S/C17H28N2O4/c1-11(2)14(10-19-16(22)23-17(3,4)5)18-9-12-6-7-13(20)8-15(12)21/h6-8,11,14,18,20-21H,9-10H2,1-5H3,(H,19,22) |
| InChIKey | IXIYVBJFAXEFMD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|