C17H27ClN2O3 — CID 107254174
tert-butyl N-[2-[(5-chloro-2-hydroxyphenyl)methylamino]-3-methylbutyl]carbamate (PubChem CID 107254174) has the molecular formula C17H27ClN2O3 and a molecular weight of 342.87 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-chloro-2-hydroxyphenyl)methylamino]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-chloro-2-hydroxyphenyl)methylamino]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 107254174 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | tert-butyl N-[2-[(5-chloro-2-hydroxyphenyl)methylamino]-3-methylbutyl]carbamate |
| SMILES | CC(C)C(CNC(=O)OC(C)(C)C)NCc1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H27ClN2O3/c1-11(2)14(10-20-16(22)23-17(3,4)5)19-9-12-8-13(18)6-7-15(12)21/h6-8,11,14,19,21H,9-10H2,1-5H3,(H,20,22) |
| InChIKey | NSIAEKGARGVHJI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|