C15H22ClNO3 — CID 102538086
tert-butyl N-[(5-chloro-2-propan-2-yloxyphenyl)methyl]carbamate (PubChem CID 102538086) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is tert-butyl N-[(5-chloro-2-propan-2-yloxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(5-chloro-2-propan-2-yloxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 102538086 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | tert-butyl N-[(5-chloro-2-propan-2-yloxyphenyl)methyl]carbamate |
| SMILES | CC(C)Oc1ccc(Cl)cc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22ClNO3/c1-10(2)19-13-7-6-12(16)8-11(13)9-17-14(18)20-15(3,4)5/h6-8,10H,9H2,1-5H3,(H,17,18) |
| InChIKey | FFQASSKQBTYGFY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |